|
CAS#: 13311-72-3 Product: 4-Bromo-2,3,6-Trichlorophenol No suppilers available for the product. |
| Name | 4-Bromo-2,3,6-Trichlorophenol |
|---|---|
| Synonyms | 4-Bromo-2,3,6-Trichloro-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2BrCl3O |
| Molecular Weight | 276.34 |
| CAS Registry Number | 13311-72-3 |
| EINECS | 236-340-3 |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Cl)O)Cl |
| InChI | 1S/C6H2BrCl3O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H |
| InChIKey | QXTYKQOYAPZQOA-UHFFFAOYSA-N |
| Density | 1.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.948°C at 760 mmHg (Cal.) |
| Flash point | 124.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2,3,6-Trichlorophenol |