|
CAS#: 13318-18-8 Product: Octahydro-4,7-Methano-1H-Indene-1,2,5-Triol No suppilers available for the product. |
| Name | Octahydro-4,7-Methano-1H-Indene-1,2,5-Triol |
|---|---|
| Synonyms | Octahydro-4,7-Methano-1H-Indene-1,2,5-Triol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 |
| CAS Registry Number | 13318-18-8 |
| EINECS | 236-350-8 |
| SMILES | C3C1C(C2CC1C(C2)O)C(C3O)O |
| InChI | 1S/C10H16O3/c11-7-2-4-1-5(7)6-3-8(12)10(13)9(4)6/h4-13H,1-3H2 |
| InChIKey | RWQFKYRYAQYIQR-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.269°C at 760 mmHg (Cal.) |
| Flash point | 167.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-4,7-Methano-1H-Indene-1,2,5-Triol |