Online Database of Chemicals from Around the World
|
CAS#: 13327-36-1 Product: 5-Benzylidenefuran-2(5H)-One No suppilers available for the product. |
| Name | 5-Benzylidenefuran-2(5H)-One |
|---|---|
| Synonyms | (5Z)-5-(Phenylmethylene)Furan-2-One; (5Z)-5-(Phenylmethylene)-2-Furanone; (5Z)-5-(Benzylidene)Furan-2-One |
| Molecular Structure |  |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 13327-36-1 |
| EINECS | 236-369-1 |
| SMILES | C2=C(\C=C1/OC(=O)C=C1)C=CC=C2 |
| InChI | 1S/C11H8O2/c12-11-7-6-10(13-11)8-9-4-2-1-3-5-9/h1-8H/b10-8- |
| InChIKey | DMWDECPSZZVGPO-NTMALXAHSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.909°C at 760 mmHg (Cal.) |
| Flash point | 145.768°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Benzylidenefuran-2(5H)-One |