|
CAS#: 13337-33-2 Product: 1-Dichlorophosphoryl-3-Methyl-Buta-1,2-Diene No suppilers available for the product. |
| Name | 1-Dichlorophosphoryl-3-Methyl-Buta-1,2-Diene |
|---|---|
| Synonyms | 1-Dichlorophosphoryl-3-Methyl-Buta-1,2-Diene; Phosphonic Dichloride, (3-Methyl-1,2-Butadienyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7Cl2OP |
| Molecular Weight | 184.99 |
| CAS Registry Number | 13337-33-2 |
| SMILES | C[C](=[C]=[CH][P](=O)(Cl)Cl)C |
| InChI | 1S/C5H7Cl2OP/c1-5(2)3-4-9(6,7)8/h4H,1-2H3 |
| InChIKey | WBWKMWRLRXOVAW-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.761°C at 760 mmHg (Cal.) |
| Flash point | 98.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dichlorophosphoryl-3-Methyl-Buta-1,2-Diene |