|
CAS#: 13345-62-5 Product: 7-Chloromethyl-12-Methylbenz(a)Anthracene No suppilers available for the product. |
| Name | 7-Chloromethyl-12-Methylbenz(a)Anthracene |
|---|---|
| Synonyms | 7-(Chloromethyl)-12-Methyl-Benzo[B]Phenanthrene; Benz[A]Anthracene, 7-(Chloromethyl)-12-Methyl-; Irc 453 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15Cl |
| Molecular Weight | 290.79 |
| CAS Registry Number | 13345-62-5 |
| SMILES | C1=C4C(=C2C(=C1)C=CC=C2)C(=C3C=CC=CC3=C4CCl)C |
| InChI | 1S/C20H15Cl/c1-13-15-7-4-5-9-17(15)19(12-21)18-11-10-14-6-2-3-8-16(14)20(13)18/h2-11H,12H2,1H3 |
| InChIKey | IKWYHKBBMXJHNN-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.63°C at 760 mmHg (Cal.) |
| Flash point | 235.43°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-Chloromethyl-12-Methylbenz(a)Anthracene |