|
CAS#: 133486-62-1 Product: 1-(Bromomethyl)-3-Methoxy-2-Nitrobenzene No suppilers available for the product. |
| Name | 1-(Bromomethyl)-3-Methoxy-2-Nitrobenzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H8BrNO3 |
| Molecular Weight | 246.06 |
| CAS Registry Number | 133486-62-1 |
| SMILES | [O-][N+](=O)c1c(cccc1OC)CBr |
| InChI | 1S/C8H8BrNO3/c1-13-7-4-2-3-6(5-9)8(7)10(11)12/h2-4H,5H2,1H3 |
| InChIKey | OGGQVUNUXHDQNZ-UHFFFAOYSA-N |
| Density | 1.59g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.927°C at 760 mmHg (Cal.) |
| Flash point | 152.73°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Bromomethyl)-3-Methoxy-2-Nitrobenzene |