|
CAS#: 13354-38-6 Product: 2-Sulfanyl-9,10-Anthraquinone No suppilers available for the product. |
| Name | 2-Sulfanyl-9,10-Anthraquinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O2S |
| Molecular Weight | 240.28 |
| CAS Registry Number | 13354-38-6 |
| SMILES | Sc2ccc3C(=O)c1ccccc1C(=O)c3c2 |
| InChI | 1S/C14H8O2S/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(17)5-6-11(12)13/h1-7,17H |
| InChIKey | WUWVLTIKBWZFTM-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.514°C at 760 mmHg (Cal.) |
| Flash point | 227.472°C (Cal.) |
| Refractive index | 1.707 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Sulfanyl-9,10-Anthraquinone |