|
CAS#: 133544-77-1 Product: 3-(2,4-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-3-Methylbutanoic Acid No suppilers available for the product. |
| Name | 3-(2,4-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-3-Methylbutanoic Acid |
|---|---|
| Synonyms | 3-(2,4-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-3-Methyl-Butanoic Acid; 3-(3,6-Diketo-2,4-Dimethyl-1-Cyclohexa-1,4-Dienyl)-3-Methyl-Butyric Acid; 1,4-Cyclohexadiene-1-Propanoic Acid, Beta,Beta,2,4-Tetramethyl-3,6-Dioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 133544-77-1 |
| SMILES | C(C(=O)O)C(C1=C(C(C(=CC1=O)C)=O)C)(C)C |
| InChI | 1S/C13H16O4/c1-7-5-9(14)11(8(2)12(7)17)13(3,4)6-10(15)16/h5H,6H2,1-4H3,(H,15,16) |
| InChIKey | JHOMCQALRKZDFZ-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.257°C at 760 mmHg (Cal.) |
| Flash point | 193.718°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,4-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-3-Methylbutanoic Acid |