|
CAS#: 13366-36-4 Product: Dimethylstilbestrol No suppilers available for the product. |
| Name | Dimethylstilbestrol |
|---|---|
| Synonyms | 4-[3-(4-Hydroxyphenyl)But-2-En-2-Yl]Phenol; 4-[(E)-2-(4-Hydroxyphenyl)-1-Methyl-Prop-1-Enyl]Phenol; 4-[2-(4-Hydroxyphenyl)-1-Methyl-Prop-1-Enyl]Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 13366-36-4 (552-80-7) |
| SMILES | C2=C(C(=C(C1=CC=C(O)C=C1)\C)/C)C=CC(=C2)O |
| InChI | 1S/C16H16O2/c1-11(13-3-7-15(17)8-4-13)12(2)14-5-9-16(18)10-6-14/h3-10,17-18H,1-2H3/b12-11+ |
| InChIKey | XPINIPXARSNZDM-VAWYXSNFSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.987°C at 760 mmHg (Cal.) |
| Flash point | 178.751°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylstilbestrol |