|
CAS#: 13370-48-4 Product: (4-Chloro-2,5-Dimethylphenoxy)Acetic Acid No suppilers available for the product. |
| Name | (4-Chloro-2,5-Dimethylphenoxy)Acetic Acid |
|---|---|
| Synonyms | 2-(4-Chloro-2,5-Dimethyl-Phenoxy)Acetic Acid; 2-(4-Chloro-2,5-Dimethyl-Phenoxy)Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 |
| CAS Registry Number | 13370-48-4 |
| EINECS | 236-440-7 |
| SMILES | C1=C(C(=CC(=C1OCC(=O)O)C)Cl)C |
| InChI | 1S/C10H11ClO3/c1-6-4-9(14-5-10(12)13)7(2)3-8(6)11/h3-4H,5H2,1-2H3,(H,12,13) |
| InChIKey | FYSOXVMOZFIWIU-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.142°C at 760 mmHg (Cal.) |
| Flash point | 162.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Chloro-2,5-Dimethylphenoxy)Acetic Acid |