|
CAS#: 13376-40-4 Product: 2,5-Dichloro-4-Cyclohexylphenylacetic Acid No suppilers available for the product. |
| Name | 2,5-Dichloro-4-Cyclohexylphenylacetic Acid |
|---|---|
| Synonyms | 2-(2,5-Dichloro-4-Cyclohexyl-Phenyl)Acetic Acid; 2-(2,5-Dichloro-4-Cyclohexyl-Phenyl)Ethanoic Acid; (2,5-Dichloro-4-Cyclohexylphenyl)Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16Cl2O2 |
| Molecular Weight | 287.19 |
| CAS Registry Number | 13376-40-4 |
| SMILES | C2=C(C1CCCCC1)C(=CC(=C2Cl)CC(O)=O)Cl |
| InChI | 1S/C14H16Cl2O2/c15-12-8-11(9-4-2-1-3-5-9)13(16)6-10(12)7-14(17)18/h6,8-9H,1-5,7H2,(H,17,18) |
| InChIKey | NTYFWSQPZNEZFR-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.777°C at 760 mmHg (Cal.) |
| Flash point | 199.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichloro-4-Cyclohexylphenylacetic Acid |