|
CAS#: 13379-67-4 Product: (Pentafluorophenyl)Phosphonous Dibromide No suppilers available for the product. |
| Name | (Pentafluorophenyl)Phosphonous Dibromide |
|---|---|
| Synonyms | 2,3,4,5,6-Pentafluorophenylphosphonous dibromide #; PENTAFLUOROPHENYLDIBROMOPHOSPHINE |
| Molecular Structure | ![]() |
| Molecular Formula | C6Br2F5P |
| Molecular Weight | 357.84 |
| CAS Registry Number | 13379-67-4 |
| SMILES | Fc1c(F)c(F)c(F)c(F)c1P(Br)Br |
| InChI | 1S/C6Br2F5P/c7-14(8)6-4(12)2(10)1(9)3(11)5(6)13 |
| InChIKey | REMGEPKWEWKCEZ-UHFFFAOYSA-N |
| Boiling point | 244.905°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101.915°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Pentafluorophenyl)Phosphonous Dibromide |