|
CAS#: 13391-39-4 Product: 1-Chloro-3-(Chlorophenylmethyl)Benzene No suppilers available for the product. |
| Name | 1-Chloro-3-(Chlorophenylmethyl)Benzene |
|---|---|
| Synonyms | 1-Chloro-3-(Chloro-Phenyl-Methyl)Benzene; 1-Chloro-3-(Chlorophenylmethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | 237.13 |
| CAS Registry Number | 13391-39-4 |
| EINECS | 236-470-0 |
| SMILES | C1=CC=CC=C1C(Cl)C2=CC(=CC=C2)Cl |
| InChI | 1S/C13H10Cl2/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9,13H |
| InChIKey | FCSFSWLSKOMQFX-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.825°C at 760 mmHg (Cal.) |
| Flash point | 139.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3-(Chlorophenylmethyl)Benzene |