| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | {[3-(4-Chlorophenyl)-3-Oxo-1-Phenylpropyl]Sulfanyl}Acetic Acid |
|---|---|
| Synonyms | 2-(3-(4-Chlorophenyl)-3-oxo-1-phenylpropylthio)acetic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15ClO3S |
| Molecular Weight | 334.82 |
| CAS Registry Number | 133961-81-6 |
| SMILES | C1=CC=C(C=C1)C(CC(=O)C2=CC=C(C=C2)Cl)SCC(=O)O |
| InChI | 1S/C17H15ClO3S/c18-14-8-6-12(7-9-14)15(19)10-16(22-11-17(20)21)13-4-2-1-3-5-13/h1-9,16H,10-11H2,(H,20,21) |
| InChIKey | GKJHKTABFYRMPR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 285.3±30.1°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| (1) | Hindie et al.. Structure and allosteric effects of low molecular weight activators on the protein kinase PDK1, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for {[3-(4-Chlorophenyl)-3-Oxo-1-Phenylpropyl]Sulfanyl}Acetic Acid |