|
CAS#: 13408-58-7 Product: Dichlorocopper - Pyridine (1:2) No suppilers available for the product. |
| Name | Dichlorocopper - Pyridine (1:2) |
|---|---|
| Synonyms | Bis(pyridine)copper chloride; Bis(pyridinio)dichlorocuprate(II) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2CuN2 |
| Molecular Weight | 292.65 |
| CAS Registry Number | 13408-58-7 |
| SMILES | Cl[Cu]Cl.n1ccccc1.n1ccccc1 |
| InChI | 1S/2C5H5N.2ClH.Cu/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | UBNQPNIJAJFCJK-UHFFFAOYSA-L |
| Boiling point | 115.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 20°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichlorocopper - Pyridine (1:2) |