Online Database of Chemicals from Around the World
|
CAS#: 13418-50-3 Product: 4,11-Diamino-2,3-Dihydro-3-Imino-1H-Naphth[2,3-f]Isoindole-1,5,10-Trione No suppilers available for the product. |
| Name | 4,11-Diamino-2,3-Dihydro-3-Imino-1H-Naphth[2,3-f]Isoindole-1,5,10-Trione |
|---|---|
| Synonyms | 1H-Naphth(2,3-F)Isoindole-1,5,10-Trione, 4,11-Diamino-2,3-Dihydro-3-Imino- |
| Molecular Structure | ![CAS#: 13418-50-3, 4,11-Diamino-2,3-Dihydro-3-Imino-1H-Naphth[2,3-f]Isoindole-1,5,10-Trione](/moreStructures/13418-50-3.gif) |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 |
| CAS Registry Number | 13418-50-3 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=C4C(=C3N)C(=NC4=O)N)N |
| InChI | 1S/C16H10N4O3/c17-11-7-8(12(18)10-9(11)15(19)20-16(10)23)14(22)6-4-2-1-3-5(6)13(7)21/h1-4H,17-18H2,(H2,19,20,23) |
| InChIKey | ZRWPJWRJYCWZGD-UHFFFAOYSA-N |
| Density | 1.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 750.605°C at 760 mmHg (Cal.) |
| Flash point | 407.751°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,11-Diamino-2,3-Dihydro-3-Imino-1H-Naphth[2,3-f]Isoindole-1,5,10-Trione |