|
CAS#: 13427-80-0 Product: Terephthalic Acid Dipotassium Salt No suppilers available for the product. |
| Name | Terephthalic Acid Dipotassium Salt |
|---|---|
| Synonyms | 1,4-Benzenedicarboxylic Acid, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4K2O4 |
| Molecular Weight | 242.31 |
| CAS Registry Number | 13427-80-0 |
| SMILES | C1=C(C=CC(=C1)C([O-])=O)C([O-])=O.[K+].[K+] |
| InChI | 1S/C8H6O4.2K/c9-7(10)5-1-2-6(4-3-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | LRUDDHYVRFQYCN-UHFFFAOYSA-L |
| Boiling point | 392.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Terephthalic Acid Dipotassium Salt |