|
CAS#: 13433-19-7 Product: Glycyl-Aspartyl-Glycine No suppilers available for the product. |
| Name | Glycyl-Aspartyl-Glycine |
|---|---|
| Synonyms | (3S)-3-Amino-4-[[2-(Carboxymethylamino)-2-Oxo-Ethyl]Amino]-4-Oxo-Butanoic Acid; (3S)-3-Amino-4-[[2-(Carboxymethylamino)-2-Keto-Ethyl]Amino]-4-Keto-Butyric Acid; Glycine, N-(N-L-Alpha-Aspartylglycyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 |
| CAS Registry Number | 13433-19-7 |
| SMILES | [C@H](C(NCC(NCC(=O)O)=O)=O)(N)CC(=O)O |
| InChI | 1S/C8H13N3O6/c9-4(1-6(13)14)8(17)11-2-5(12)10-3-7(15)16/h4H,1-3,9H2,(H,10,12)(H,11,17)(H,13,14)(H,15,16)/t4-/m0/s1 |
| InChIKey | OMMIEVATLAGRCK-BYPYZUCNSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 740.287°C at 760 mmHg (Cal.) |
| Flash point | 401.511°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glycyl-Aspartyl-Glycine |