|
CAS#: 13445-62-0 Product: calcium 2,2-dichlorovinyl methyl phosphate No suppilers available for the product. |
| Name | calcium 2,2-dichlorovinyl methyl phosphate |
|---|---|
| Synonyms | Calcium 2,2-Dichlorovinyl Methyl Phosphate; K 701; Phosphoric Acid, Mono(2,2-Dichloroethenyl) Monomethyl Ester, Calcium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8CaCl4O8P2 |
| Molecular Weight | 451.96 |
| CAS Registry Number | 13445-62-0 |
| SMILES | CO[P](OC=C(Cl)Cl)([O-])=O.CO[P](OC=C(Cl)Cl)([O-])=O.[Ca++] |
| InChI | 1S/2C3H5Cl2O4P.Ca/c2*1-8-10(6,7)9-2-3(4)5;/h2*2H,1H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | HPKCDFUFJXFCKD-UHFFFAOYSA-L |
| Boiling point | 216.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 84.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for calcium 2,2-dichlorovinyl methyl phosphate |