Online Database of Chemicals from Around the World
|
CAS#: 13450-71-0 Product: Methyl 2-{(2-Aminophenyl)[3-(Methylamino)Propyl]Amino}Benzoate No suppilers available for the product. |
| Name | Methyl 2-{(2-Aminophenyl)[3-(Methylamino)Propyl]Amino}Benzoate |
|---|---|
| Synonyms | Methyl 2-(2-amino[3-(methylamino)propyl]anilino)benzoate # |
| Molecular Structure | ![CAS#: 13450-71-0, Methyl 2-{(2-Aminophenyl)[3-(Methylamino)Propyl]Amino}Benzoate](/moreStructures/13450-71-0.gif) |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.39 |
| CAS Registry Number | 13450-71-0 |
| SMILES | O=C(OC)c2ccccc2N(c1ccccc1N)CCCNC |
| InChI | 1S/C18H23N3O2/c1-20-12-7-13-21(17-11-6-4-9-15(17)19)16-10-5-3-8-14(16)18(22)23-2/h3-6,8-11,20H,7,12-13,19H2,1-2H3 |
| InChIKey | BXENWNJCBCMLPI-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.08°C at 760 mmHg (Cal.) |
| Flash point | 245.958°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-{(2-Aminophenyl)[3-(Methylamino)Propyl]Amino}Benzoate |