| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Phenylpenta-2,4-Dienal |
|---|---|
| Synonyms | 2,4-Pentadienal, 5-Phenyl-; 5-Phenylpenta-2,4-Dienal; Benzylidenecrotonaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 |
| CAS Registry Number | 13466-40-5 |
| EINECS | 236-718-8 |
| SMILES | C1=CC=C(C=C1)\C=C\C=C\C=O |
| InChI | 1S/C11H10O/c12-10-6-2-5-9-11-7-3-1-4-8-11/h1-10H/b6-2+,9-5+ |
| InChIKey | UWTZBVTWSKWXMN-VDESZNBCSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.099°C at 760 mmHg (Cal.) |
| Flash point | 109.249°C (Cal.) |
| (1) | Deepa Janardanan and Raghavan B. Sunoj. Chemo-, regio-, and diastereoselectivity preferences in the reaction of a sulfur ylide with a dienal and an enone, Org. Biomol. Chem., 2011, 9, 1642. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Phenylpenta-2,4-Dienal |