Online Database of Chemicals from Around the World
|
CAS#: 134746-11-5 Product: (2Z,4Z,6Z)-2-Phenyl-1-Benzazocin-8-Ol No suppilers available for the product. |
| Name | (2Z,4Z,6Z)-2-Phenyl-1-Benzazocin-8-Ol |
|---|---|
| Synonyms | 1-Benzazocin-8-Ol, 2-Phenyl-; Hypodematine |
| Molecular Structure |  |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 |
| CAS Registry Number | 134746-11-5 |
| SMILES | C3=C(\C1=C\C=C/C=C/2C(=N1)C=CC(=C2)O)C=CC=C3 |
| InChI | 1S/C17H13NO/c19-15-10-11-17-14(12-15)8-4-5-9-16(18-17)13-6-2-1-3-7-13/h1-12,19H/b5-4-,8-4?,9-5?,14-8-,16-9-,18-16?,18-17? |
| InChIKey | DLUVDUDDNZLZCS-KDFWHVBTSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.128°C at 760 mmHg (Cal.) |
| Flash point | 295.155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z,4Z,6Z)-2-Phenyl-1-Benzazocin-8-Ol |