|
CAS#: 135138-42-0 Product: 1,1-Dioxo-3-(Phenylmethoxy)-3,3a,4,7a-Tetrahydro-2H-1-Benzothiophen-5-One No suppilers available for the product. |
| Name | 1,1-Dioxo-3-(Phenylmethoxy)-3,3a,4,7a-Tetrahydro-2H-1-Benzothiophen-5-One |
|---|---|
| Synonyms | 1,1-Dioxo-3-(Phenylmethoxy)-3,3A,4,7A-Tetrahydro-2H-Benzothiophen-5-One; 3-(Benzyloxy)-1,1-Diketo-3,3A,4,7A-Tetrahydro-2H-Benzothiophen-5-One; 3-Benzyloxy-2,3,3A,7A-Tetrahydrobenzothiophen-5-(4H)-One-1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.35 |
| CAS Registry Number | 135138-42-0 |
| SMILES | C1=CC=CC=C1COC2C[S](C3C2CC(C=C3)=O)(=O)=O |
| InChI | 1S/C15H16O4S/c16-12-6-7-15-13(8-12)14(10-20(15,17)18)19-9-11-4-2-1-3-5-11/h1-7,13-15H,8-10H2 |
| InChIKey | WPOOONGUNIWHDE-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.861°C at 760 mmHg (Cal.) |
| Flash point | 272.436°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dioxo-3-(Phenylmethoxy)-3,3a,4,7a-Tetrahydro-2H-1-Benzothiophen-5-One |