|
CAS#: 135211-31-3 Product: (1R,2S)-2-(Alanylamino)Cyclopentanecarboxylic Acid No suppilers available for the product. |
| Name | (1R,2S)-2-(Alanylamino)Cyclopentanecarboxylic Acid |
|---|---|
| Synonyms | (1R,2S)-2-(2-aminopropanamido)cyclopentanecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 135211-31-3 |
| SMILES | CC(C(=O)N[C@H]1CCC[C@H]1C(=O)O)N |
| InChI | 1S/C9H16N2O3/c1-5(10)8(12)11-7-4-2-3-6(7)9(13)14/h5-7H,2-4,10H2,1H3,(H,11,12)(H,13,14)/t5?,6-,7+/m1/s1 |
| InChIKey | OWZOYVBEPMTISC-FWPZAIACSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.78°C at 760 mmHg (Cal.) |
| Flash point | 229.448°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-(Alanylamino)Cyclopentanecarboxylic Acid |