|
CAS#: 13524-76-0 Product: 3,3-Dimethylbenzofuran-2(3H)-One No suppilers available for the product. |
| Name | 3,3-Dimethylbenzofuran-2(3H)-One |
|---|---|
| Synonyms | 3,3-Dimethylbenzofuran-2-One; 3,3-Dimethyl-2-Benzofuranone; 3,3-Dimethyl-1-Benzofuran-2(3H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 13524-76-0 |
| SMILES | C1=CC2=C(C=C1)C(C)(C)C(O2)=O |
| InChI | 1S/C10H10O2/c1-10(2)7-5-3-4-6-8(7)12-9(10)11/h3-6H,1-2H3 |
| InChIKey | NETNPVWFZRPOFL-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.128°C at 760 mmHg (Cal.) |
| Flash point | 86.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethylbenzofuran-2(3H)-One |