|
CAS#: 135357-25-4 Product: Ganosporeric Acid A No suppilers available for the product. |
| Name | Ganosporeric Acid A |
|---|---|
| Synonyms | (2R,6R)-4-Keto-2-Methyl-6-[(10S,13R,14R,17R)-3,7,11,12,15-Pentaketo-4,4,10,13,14-Pentamethyl-1,2,5,6,16,17-Hexahydrocyclopenta[A]Phenanthren-17-Yl]Enanthic Acid; Lanost-8-En-26-Oic Acid, 3,7,11,12,15,23-Hexaoxo-, (25R)-; 3,7,11,12,15,23-Hexanoxo-5Alpha-Lanosta-8-En-26-Oic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 |
| CAS Registry Number | 135357-25-4 |
| SMILES | [C@]34([C@](C1=C([C@@]2(C(CC1=O)C(C(=O)CC2)(C)C)C)C(=O)C3=O)(C(=O)C[C@@H]4[C@@H](CC(=O)C[C@H](C(=O)O)C)C)C)C |
| InChI | 1S/C30H38O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17,19H,8-13H2,1-7H3,(H,37,38)/t14-,15-,17-,19?,28+,29+,30+/m1/s1 |
| InChIKey | AKWNYHCILPEENZ-GESKOEBASA-N |
| Density | 1.265g/cm3 (Cal.) |
|---|---|
| Boiling point | 685.296°C at 760 mmHg (Cal.) |
| Flash point | 382.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ganosporeric Acid A |