|
CAS#: 135401-87-5 Product: 1,1,1,2,2,3,3-Heptachloro-3-Fluoropropane No suppilers available for the product. |
| Name | 1,1,1,2,2,3,3-Heptachloro-3-Fluoropropane |
|---|---|
| Synonyms | CFC-211 |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl7F |
| Molecular Weight | 303.20 |
| CAS Registry Number | 135401-87-5 |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)F |
| InChI | 1S/C3Cl7F/c4-1(5,2(6,7)8)3(9,10)11 |
| InChIKey | UVWLSLSDRXOZKU-UHFFFAOYSA-N |
| Density | 1.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.647°C at 760 mmHg (Cal.) |
| Flash point | 106.474°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2,3,3-Heptachloro-3-Fluoropropane |