|
CAS#: 135467-93-5 Product: Phenyl N-Ethyl-N-Methylcarbamate No suppilers available for the product. |
| Name | Phenyl N-Ethyl-N-Methylcarbamate |
|---|---|
| Synonyms | Phenyl N-Ethyl-N-Methyl-Carbamate; N-Ethyl-N-Methylcarbamic Acid Phenyl Ester; N-Ethyl-N-Methyl-Carbamic Acid Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 135467-93-5 |
| SMILES | C1=C(OC(N(CC)C)=O)C=CC=C1 |
| InChI | 1S/C10H13NO2/c1-3-11(2)10(12)13-9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | CMEHRSPFSMBENE-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.642°C at 760 mmHg (Cal.) |
| Flash point | 106.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl N-Ethyl-N-Methylcarbamate |