|
CAS#: 13567-41-4 Product: (+)-8(15)-Cedren-9-ol No suppilers available for the product. |
| Name | (+)-8(15)-Cedren-9-ol |
|---|---|
| Synonyms | (+)-8(15)-Cedren-9-ol; 1H-3a,7-M |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 13567-41-4 |
| SMILES | OC1C(=C)/C2CC3(C1)C(CCC3C2(C)C)C |
| InChI | 1S/C15H24O/c1-9-5-6-13-14(3,4)11-7-15(9,13)8-12(16)10(11)2/h9,11-13,16H,2,5-8H2,1,3-4H3 |
| InChIKey | DJYWGTBEZVORGE-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.053°C at 760 mmHg (Cal.) |
| Flash point | 120.901°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (+)-8(15)-Cedren-9-ol |