|
CAS#: 13577-85-0 Product: N,N-Dimethyl-2-Naphthamide No suppilers available for the product. |
| Name | N,N-Dimethyl-2-Naphthamide |
|---|---|
| Synonyms | N,N-Dimethyl-2-naphthamide; N,N-dimethylnaphthalene-2-carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| CAS Registry Number | 13577-85-0 |
| SMILES | O=C(N(C)C)c2ccc1c(cccc1)c2 |
| InChI | 1S/C13H13NO/c1-14(2)13(15)12-8-7-10-5-3-4-6-11(10)9-12/h3-9H,1-2H3 |
| InChIKey | DXKBTRRRWABXMX-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.442°C at 760 mmHg (Cal.) |
| Flash point | 172.354°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-2-Naphthamide |