Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Parethoxycaine Hydrochloride |
|---|---|
| Synonyms | 4-Ethoxybenzoic Acid 2-Diethylaminoethyl Ester Hydrochloride; Mls000534383; Smr000141815 |
| Molecular Structure |  |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 |
| CAS Registry Number | 136-46-9 |
| EINECS | 205-246-4 |
| SMILES | [H+].C1=C(C(OCCN(CC)CC)=O)C=CC(=C1)OCC.[Cl-] |
| InChI | 1S/C15H23NO3.ClH/c1-4-16(5-2)11-12-19-15(17)13-7-9-14(10-8-13)18-6-3;/h7-10H,4-6,11-12H2,1-3H3;1H |
| InChIKey | SFLZPZAKIKUJKP-UHFFFAOYSA-N |
| Boiling point | 366.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Parethoxycaine Hydrochloride |