| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Trimethylsilyl 1,1,2,2-Tetrafluoro-2-(Pentafluoroethoxy)Ethanesulfonate |
|---|---|
| Synonyms | MFCD00155955; Trimethylsilyl perfluoro(2-ethoxyethane)sulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9F9O4SSi |
| Molecular Weight | 388.28 |
| CAS Registry Number | 136049-37-1 |
| SMILES | O=S(=O)(O[Si](C)(C)C)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | 1S/C7H9F9O4SSi/c1-22(2,3)20-21(17,18)7(15,16)6(13,14)19-5(11,12)4(8,9)10/h1-3H3 |
| InChIKey | TXHZECVJWFWGDH-UHFFFAOYSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.618°C at 760 mmHg (Cal.) |
| Flash point | 94.485°C (Cal.) |
| Refractive index | 1.35 (Cal.) |
| Safety Description | S24/25,S36/37/39,S45 |
|---|---|
| R36/37/38 | |
| Irritant | |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 1,1,2,2-Tetrafluoro-2-(Pentafluoroethoxy)Ethanesulfonate |