|
CAS#: 136105-62-9 Product: 2,2'-Diimino-5,5'-diisopropyl-7,7'-dimethyl-2H, 2'H-[8,8']bi[naphtho[1,8-bc]furanyl]-3,4,3',4'-tetraol No suppilers available for the product. |
| Name | 2,2'-Diimino-5,5'-diisopropyl-7,7'-dimethyl-2H, 2'H-[8,8']bi[naphtho[1,8-bc]furanyl]-3,4,3',4'-tetraol |
|---|---|
| Synonyms | Aids-051908; Aids-003523; Aids003523 |
| Molecular Structure | ![]() |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 |
| CAS Registry Number | 136105-62-9 |
| SMILES | C2=C(C(=C1OC(=C3C1=C2C(=C(O)C3=O)C(C)C)N)C6=C4OC(=C5C4=C(C(=C(O)C5=O)C(C)C)C=C6C)N)C |
| InChI | 1S/C30H28N2O6/c1-9(2)15-13-7-11(5)17(27-19(13)21(29(31)37-27)25(35)23(15)33)18-12(6)8-14-16(10(3)4)24(34)26(36)22-20(14)28(18)38-30(22)32/h7-10,33-34H,31-32H2,1-6H3 |
| InChIKey | LAHOTINDQQFYCH-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 742.875°C at 760 mmHg (Cal.) |
| Flash point | 403.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Diimino-5,5'-diisopropyl-7,7'-dimethyl-2H, 2'H-[8,8']bi[naphtho[1,8-bc]furanyl]-3,4,3',4'-tetraol |