|
CAS#: 13629-82-8 Product: 3,3'-Dimethyl-4-(1,1'-Biphenyl)Amine No suppilers available for the product. |
| Name | 3,3'-Dimethyl-4-(1,1'-Biphenyl)Amine |
|---|---|
| Synonyms | [2-Methyl-4-(3-Methylphenyl)Phenyl]Amine; 3,3'-Dimethyl-4-Aminobiphenyl; 3,3'-Dimethyl-4-Aminodiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 13629-82-8 |
| SMILES | C1=CC=C(C=C1C2=CC(=C(C=C2)N)C)C |
| InChI | 1S/C14H15N/c1-10-4-3-5-12(8-10)13-6-7-14(15)11(2)9-13/h3-9H,15H2,1-2H3 |
| InChIKey | BVXLFLQATMVEKU-UHFFFAOYSA-N |
| Density | 1.041g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.541°C at 760 mmHg (Cal.) |
| Flash point | 154.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dimethyl-4-(1,1'-Biphenyl)Amine |