Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | N-[3',6'-Bis(Dimethylamino)-3-Oxo-3H-Spiro[2-Benzofuran-1,9'-Xanthen]-5-Yl]-2-Iodoacetamide |
|---|---|
| Synonyms | 5(6)-Iodoacetamidotetramethylrhodamine; 6-IATR; IATR |
| Molecular Structure | ![CAS#: 136538-85-7, N-[3',6'-Bis(Dimethylamino)-3-Oxo-3H-Spiro[2-Benzofuran-1,9'-Xanthen]-5-Yl]-2-Iodoacetamide](/moreStructures/136538-85-7.gif) |
| Molecular Formula | C26H24IN3O4 |
| Molecular Weight | 569.39 |
| CAS Registry Number | 136538-85-7 |
| SMILES | ICC(=O)Nc1cc2c(cc1)C4(OC2=O)c5ccc(N(C)C)cc5Oc3cc(N(C)C)ccc34 |
| InChI | 1S/C26H24IN3O4/c1-29(2)16-6-9-20-22(12-16)33-23-13-17(30(3)4)7-10-21(23)26(20)19-8-5-15(28-24(31)14-27)11-18(19)25(32)34-26/h5-13H,14H2,1-4H3,(H,28,31) |
| InChIKey | HENCSKZMSUJDLA-UHFFFAOYSA-N |
| Density | 1.646g/cm3 (Cal.) |
|---|---|
| Boiling point | 761.643°C at 760 mmHg (Cal.) |
| Flash point | 414.427°C (Cal.) |
| Refractive index | 1.724 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[3',6'-Bis(Dimethylamino)-3-Oxo-3H-Spiro[2-Benzofuran-1,9'-Xanthen]-5-Yl]-2-Iodoacetamide |