|
CAS#: 13665-49-1 Product: Pentachloronitrosobenzene No suppilers available for the product. |
| Name | Pentachloronitrosobenzene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Nitroso-Benzene; Pentachloronitrosobenzene; Benzene, Pentachloronitroso- |
| Molecular Structure | ![]() |
| Molecular Formula | C6Cl5NO |
| Molecular Weight | 279.34 |
| CAS Registry Number | 13665-49-1 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)N=O |
| InChI | 1S/C6Cl5NO/c7-1-2(8)4(10)6(12-13)5(11)3(1)9 |
| InChIKey | XDONTVVGRICUEF-UHFFFAOYSA-N |
| Density | 1.872g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.658°C at 760 mmHg (Cal.) |
| Flash point | 171.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachloronitrosobenzene |