| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Bis(4-Chlorophenyl)Phosphinous Chloride |
|---|---|
| Synonyms | Bis(4-chlorophenyl)chlorophosphine; CHLOROBIS(4-CHLOROPHENYL)PHOSPHINE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl3P |
| Molecular Weight | 289.52 |
| CAS Registry Number | 13685-26-2 |
| SMILES | C1=CC(=CC=C1P(C2=CC=C(C=C2)Cl)Cl)Cl |
| InChI | 1S/C12H8Cl3P/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | UISLTICQIVPVGS-UHFFFAOYSA-N |
| Melting point | 52-53°C (Expl.) |
|---|---|
| Boiling point | 370.4±27.0°C at 760 mmHg (Cal.) |
| 184-186°C (Expl.) | |
| Flash point | 177.8±23.7°C (Cal.) |
| Refractive index | (Cal.) |
| Safety Code | S20;S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3261 |
| Safety Description | CORROSIVE |
| DANGER: CORROSIVE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Chlorophenyl)Phosphinous Chloride |