|
CAS#: 137028-97-8 Product: (2R,5S,6R)-6-Amino-5-Hydroxy-2-(2-Methylpropyl)-4-Oxo-7-Phenylheptanoic Acid No suppilers available for the product. |
| Name | (2R,5S,6R)-6-Amino-5-Hydroxy-2-(2-Methylpropyl)-4-Oxo-7-Phenylheptanoic Acid |
|---|---|
| Synonyms | (2R,5S,6R)-6-Amino-5-Hydroxy-2-Isobutyl-4-Oxo-7-Phenyl-Heptanoic Acid; (2R,5S,6R)-6-Amino-5-Hydroxy-2-Isobutyl-4-Oxo-7-Phenylheptanoic Acid; (2R,5S,6R)-6-Amino-5-Hydroxy-2-Isobutyl-4-Keto-7-Phenyl-Enanthic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 |
| CAS Registry Number | 137028-97-8 |
| SMILES | [C@H](C(=O)O)(CC([C@H]([C@@H](CC1=CC=CC=C1)N)O)=O)CC(C)C |
| InChI | 1S/C17H25NO4/c1-11(2)8-13(17(21)22)10-15(19)16(20)14(18)9-12-6-4-3-5-7-12/h3-7,11,13-14,16,20H,8-10,18H2,1-2H3,(H,21,22)/t13-,14-,16+/m1/s1 |
| InChIKey | ZPQDBPWAVIVFGP-FMKPAKJESA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.578°C at 760 mmHg (Cal.) |
| Flash point | 274.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S,6R)-6-Amino-5-Hydroxy-2-(2-Methylpropyl)-4-Oxo-7-Phenylheptanoic Acid |