|
CAS#: 13709-27-8 Product: Bisnoryangonin No suppilers available for the product. |
| Name | Bisnoryangonin |
|---|---|
| Synonyms | 2-Hydroxy-6-[(E)-2-(4-Hydroxyphenyl)Ethenyl]Pyran-4-One; 2-Hydroxy-6-[2-(4-Hydroxyphenyl)Vinyl]Pyran-4-One; 2-Hydroxy-6-[(E)-2-(4-Hydroxyphenyl)Vinyl]Pyran-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 |
| CAS Registry Number | 13709-27-8 |
| SMILES | C2=C(\C=C\C1=CC(=O)C=C(O1)O)C=CC(=C2)O |
| InChI | 1S/C13H10O4/c14-10-4-1-9(2-5-10)3-6-12-7-11(15)8-13(16)17-12/h1-8,14,16H/b6-3+ |
| InChIKey | OZMWXKKMZNHMBC-ZZXKWVIFSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.853°C at 760 mmHg (Cal.) |
| Flash point | 195.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bisnoryangonin |