|
CAS#: 137109-78-5 Product: 3-[(4-Methylsulfonylphenyl)Methylidene]Pentane-2,4-Dione No suppilers available for the product. |
| Name | 3-[(4-Methylsulfonylphenyl)Methylidene]Pentane-2,4-Dione |
|---|---|
| Synonyms | 3-[(4-Methylsulfonylphenyl)Methylene]Pentane-2,4-Dione; 3-(4-Mesylbenzylidene)Pentane-2,4-Dione; Or-1384 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.31 |
| CAS Registry Number | 137109-78-5 |
| SMILES | C1=C([S](=O)(=O)C)C=CC(=C1)C=C(C(=O)C)C(=O)C |
| InChI | 1S/C13H14O4S/c1-9(14)13(10(2)15)8-11-4-6-12(7-5-11)18(3,16)17/h4-8H,1-3H3 |
| InChIKey | CAWYWWPWSAMGBV-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.321°C at 760 mmHg (Cal.) |
| Flash point | 351.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(4-Methylsulfonylphenyl)Methylidene]Pentane-2,4-Dione |