|
CAS#: 13716-91-1 Product: 1,5-Diamino-4,8-Dihydroxy-2-(4-Hydroxyphenyl)Anthraquinone No suppilers available for the product. |
| Name | 1,5-Diamino-4,8-Dihydroxy-2-(4-Hydroxyphenyl)Anthraquinone |
|---|---|
| Synonyms | 1,5-Diamino-4,8-Dihydroxy-2-(4-Hydroxyphenyl)-9,10-Anthraquinone; 1,5-Diamino-4,8-Dihydroxy(4-Hydroxyphenyl)Anthraquinone; 1,5-Diamino-4,8-Dihydroxy(P-Hydroxyphenyl)Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 |
| CAS Registry Number | 13716-91-1 (31529-83-6) |
| EINECS | 237-269-0 |
| SMILES | C1=C(C4=C(C(=C1C2=CC=C(C=C2)O)N)C(C3=C(C=CC(=C3C4=O)N)O)=O)O |
| InChI | 1S/C20H14N2O5/c21-11-5-6-12(24)15-14(11)19(26)16-13(25)7-10(18(22)17(16)20(15)27)8-1-3-9(23)4-2-8/h1-7,23-25H,21-22H2 |
| InChIKey | OXLITIGRBOEDEZ-UHFFFAOYSA-N |
| Density | 1.616g/cm3 (Cal.) |
|---|---|
| Boiling point | 758.891°C at 760 mmHg (Cal.) |
| Flash point | 412.762°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diamino-4,8-Dihydroxy-2-(4-Hydroxyphenyl)Anthraquinone |