|
CAS#: 13728-56-8 Product: 4-(3-Phenanthryl)Butanoic Acid No suppilers available for the product. |
| Name | 4-(3-Phenanthryl)Butanoic Acid |
|---|---|
| Synonyms | 4-(3-Phenanthryl)Butanoic Acid; 4-(3-Phenanthryl)Butyric Acid; Ncistruc1_000729 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 13728-56-8 |
| SMILES | C1=C(CCCC(O)=O)C=CC2=CC=C3C(=C12)C=CC=C3 |
| InChI | 1S/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20) |
| InChIKey | NYIVWTWKIQOBKO-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.213°C at 760 mmHg (Cal.) |
| Flash point | 383.739°C (Cal.) |
| (1) | R. E. Gerkin. 4-(3-Phenanthryl)butanoic Acid, Acta Cryst. (1997). C53, 1275-1278 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(3-Phenanthryl)Butanoic Acid |