| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| RIA International LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | L-alpha-Aspartyl-L-Lysyl-L-Phenylalanyl-L-Valylglycyl-N-Methyl-L-Leucyl-L-Norleucinamide |
|---|---|
| Synonyms | [Lys5,MeLeu9,Nle10]-NKA(4-10) |
| Molecular Structure | ![]() |
| Molecular Formula | C39H64N9O9 |
| Molecular Weight | 803.99 |
| CAS Registry Number | 137565-28-7 |
| SMILES | CCCC[C@@H](C(=O)N)NC(=O)[C@H](CC(C)C)N(C)C(=O)CNC(=O)[C@H](C(C)C)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)N |
| InChI | 1S/C39H65N9O9/c1-7-8-16-27(34(42)52)44-38(56)30(19-23(2)3)48(6)31(49)22-43-39(57)33(24(4)5)47-37(55)29(20-25-14-10-9-11-15-25)46-36(54)28(17-12-13-18-40)45-35(53)26(41)21-32(50)51/h9-11,14-15,23-24,26-30,33H,7-8,12-13,16-22,40-41H2,1-6H3,(H2,42,52)(H,43,57)(H,44,56)(H,45,53)(H,46,54)(H,47,55)(H,50,51)/t26-,27-,28-,29-,30-,33-/m0/s1 |
| InChIKey | FIBMQAYBIOYAKI-HLYNNXGTSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 1149.2±65.0°C at 760 mmHg (Cal.) |
| Flash point | 648.8±34.3°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| solubility | Soluble to 1 mg/ml in water |
| Market Analysis Reports |
| List of Reports Available for L-alpha-Aspartyl-L-Lysyl-L-Phenylalanyl-L-Valylglycyl-N-Methyl-L-Leucyl-L-Norleucinamide |