| Name | (7S)-7-Hydroxy-2,2,7-Trimethyl-5-Methylidenespiro[1,3-Dihydroindene-6,1'-Cyclopropane]-4-One |
|---|---|
| Synonyms | (7S)-7-Hydroxy-2,2,7-Trimethyl-5-Methylene-Spiro[1,3-Dihydroindene-6,1'-Cyclopropane]-4-One; (7S)-7-Hydroxy-2,2,7-Trimethyl-5-Methylene-4-Spiro[1,3-Dihydroindene-6,1'-Cyclopropane]One; (7S)-7-Hydroxy-2,2,7-Trimethyl-5-Methylidene-Spiro[1,3-Dihydroindene-6,1'-Cyclopropane]-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 137637-31-1 |
| SMILES | [C@]1(C3=C(C(C(C12CC2)=C)=O)CC(C3)(C)C)(O)C |
| InChI | 1S/C15H20O2/c1-9-12(16)10-7-13(2,3)8-11(10)14(4,17)15(9)5-6-15/h17H,1,5-8H2,2-4H3/t14-/m0/s1 |
| InChIKey | VHHHVRVVSIKHKN-AWEZNQCLSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.023°C at 760 mmHg (Cal.) |
| Flash point | 162.681°C (Cal.) |
| (1) | Arnone A, Cardillo R, Di Modugno V, Nasini G. Secondary mould metabolites. XXXIII: Structure elucidation of Illudins C-E, novel illudane sesquiterpenoids isolated from Clitocybe illudens, using one- and two-dimensional NMR spectroscopy, Gazzetta Chimica Italiana, 1991, 121, 345-348 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (7S)-7-Hydroxy-2,2,7-Trimethyl-5-Methylidenespiro[1,3-Dihydroindene-6,1'-Cyclopropane]-4-One |