Online Database of Chemicals from Around the World
|
CAS#: 13811-11-5 Product: 3,5-Diiodo-4-Hydroxyphenylpropionic Acid No suppilers available for the product. |
| Name | 3,5-Diiodo-4-Hydroxyphenylpropionic Acid |
|---|---|
| Synonyms | 3-(4-Hydroxy-3,5-Diiodo-Phenyl)Propanoic Acid; 3-(4-Hydroxy-3,5-Diiodo-Phenyl)Propionic Acid; Spectrum5_002003 |
| Molecular Structure |  |
| Molecular Formula | C9H8I2O3 |
| Molecular Weight | 417.97 |
| CAS Registry Number | 13811-11-5 |
| SMILES | C1=C(C(=C(C=C1CCC(O)=O)I)O)I |
| InChI | 1S/C9H8I2O3/c10-6-3-5(1-2-8(12)13)4-7(11)9(6)14/h3-4,14H,1-2H2,(H,12,13) |
| InChIKey | REWXSFYNOFYMNX-UHFFFAOYSA-N |
| Density | 2.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.986°C at 760 mmHg (Cal.) |
| Flash point | 184.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diiodo-4-Hydroxyphenylpropionic Acid |