|
CAS#: 13822-19-0 Product: Indoxyl Phosphate No suppilers available for the product. |
| Name | Indoxyl Phosphate |
|---|---|
| Synonyms | 1H-Indol-3-Ol, Dihydrogen Phosphate (Ester); Indoxyl Phosphate; Indoxylphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8NO4P |
| Molecular Weight | 213.13 |
| CAS Registry Number | 13822-19-0 |
| SMILES | C1=CC=CC2=C1C(=C[NH]2)O[P](=O)(O)O |
| InChI | 1S/C8H8NO4P/c10-14(11,12)13-8-5-9-7-4-2-1-3-6(7)8/h1-5,9H,(H2,10,11,12) |
| InChIKey | JTNGEYANGCBZLK-UHFFFAOYSA-N |
| Density | 1.658g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.568°C at 760 mmHg (Cal.) |
| Flash point | 258.349°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indoxyl Phosphate |