|
CAS#: 13833-26-6 Product: (2R,8R)-8-Isopropyl-1,3-Dimethyltricyclo[4.4.0.02,7]Decane No suppilers available for the product. |
| Name | (2R,8R)-8-Isopropyl-1,3-Dimethyltricyclo[4.4.0.02,7]Decane |
|---|---|
| Synonyms | Copaane |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 |
| CAS Registry Number | 13833-26-6 |
| SMILES | C3[C@@H](C1C2CCC([C@H]1C2(C)C3)C)C(C)C |
| InChI | 1S/C15H26/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h9-14H,5-8H2,1-4H3/t10?,11-,12?,13?,14-,15?/m1/s1 |
| InChIKey | LJVYOZJXUGFDJA-CEPSBPATSA-N |
| Density | 0.912g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.363°C at 760 mmHg (Cal.) |
| Flash point | 98.93°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,8R)-8-Isopropyl-1,3-Dimethyltricyclo[4.4.0.02,7]Decane |