Online Database of Chemicals from Around the World
| No suppilers available for the product. |
| Name | 1,1,2,2,3,3-Hexafluoro-1,3-Bis[(Trifluorovinyl)Oxy]Propane |
|---|---|
| Synonyms | 1,1,2-Trifluoro-2-[1,1,2,2,3,3-Hexafluoro-3-(1,2,2-Trifluoroethenoxy)Propoxy]Ethylene; 1,1,2,2,3,3-Hexafluoro-1,3-Bis((Trifluorovinyl)Oxy)Propane |
| Molecular Structure | ![CAS#: 13846-22-5, 1,1,2,2,3,3-Hexafluoro-1,3-Bis[(Trifluorovinyl)Oxy]Propane](/moreStructures/13846-22-5.gif) |
| Molecular Formula | C7F12O2 |
| Molecular Weight | 344.06 |
| CAS Registry Number | 13846-22-5 |
| EINECS | 237-579-6 |
| SMILES | C(OC(C(C(OC(F)=C(F)F)(F)F)(F)F)(F)F)(F)=C(F)F |
| InChI | 1S/C7F12O2/c8-1(9)3(12)20-6(16,17)5(14,15)7(18,19)21-4(13)2(10)11 |
| InChIKey | KGJWCQOEERZJMB-UHFFFAOYSA-N |
| Desity | 1.648g/cm3 (Cal.) |
|---|---|
| Boiling point | 151.646°C at 760 mmHg (Cal.) |
| Flash point | 51.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3-Hexafluoro-1,3-Bis[(Trifluorovinyl)Oxy]Propane |