|
CAS#: 13851-08-6 Product: 3,5,7,10-Tetramethylundec-9-Ene-4,6-Dione No suppilers available for the product. |
| Name | 3,5,7,10-Tetramethylundec-9-Ene-4,6-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 13851-08-6 |
| EINECS | 237-586-4 |
| SMILES | C(C(C(=O)C(C(=O)C(CC)C)C)C)C=C(C)C |
| InChI | 1S/C15H26O2/c1-7-11(4)14(16)13(6)15(17)12(5)9-8-10(2)3/h8,11-13H,7,9H2,1-6H3 |
| InChIKey | BZBFBQMTXDLSPW-UHFFFAOYSA-N |
| Density | 0.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.059°C at 760 mmHg (Cal.) |
| Flash point | 120.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,7,10-Tetramethylundec-9-Ene-4,6-Dione |