| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Amino-N-(2-Nitrophenyl)Acetamide |
|---|---|
| Synonyms | 2-Amino-N-(2-Nitrophenyl)Ethanamide; 2-Nitrophenylglycinamide; 2-Nitrophenylglycine Amide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 |
| CAS Registry Number | 138571-55-8 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1)NC(=O)CN |
| InChI | 1S/C8H9N3O3/c9-5-8(12)10-6-3-1-2-4-7(6)11(13)14/h1-4H,5,9H2,(H,10,12) |
| InChIKey | YLOOYNJUAMLMAA-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.073°C at 760 mmHg (Cal.) |
| Flash point | 214.506°C (Cal.) |
| (1) | Gorostiza Pau. Optical switches and triggers for the manipulation of ion channels and pores, Molecular BioSystems, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Amino-N-(2-Nitrophenyl)Acetamide |